C54H35N9 — CID 91499684
2-[4-[10-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]phenyl]-4-(2-methylphenyl)-6-pyridin-2-yl-1,3,5-triazine (PubChem CID 91499684) has the molecular formula C54H35N9 and a molecular weight of 809.94 g/mol. Its IUPAC name is 2-[4-[10-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]phenyl]-4-(2-methylphenyl)-6-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[4-[10-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]phenyl]-4-(2-methylphenyl)-6-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 91499684 |
| Molecular Formula | C54H35N9 |
| Molecular Weight | 809.94 g/mol |
| Exact Mass | 809.30 |
| IUPAC Name | 2-[4-[10-[4-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]phenyl]-4-(2-methylphenyl)-6-pyridin-2-yl-1,3,5-triazine |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(-c3c4ccccc4c(-c4ccc(-c5nc(-c6ccccn6)nc(-c6ccccn6)n5)cc4)c4ccccc34)cc2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C54H35N9/c1-34-14-2-3-15-39(34)51-58-49(59-52(62-51)44-20-8-11-31-55-44)37-27-23-35(24-28-37)47-40-16-4-6-18-42(40)48(43-19-7-5-17-41(43)47)36-25-29-38(30-26-36)50-60-53(45-21-9-12-32-56-45)63-54(61-50)46-22-10-13-33-57-46/h2-33H,1H3 |
| InChIKey | NXBFLKXEZBLHGV-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.94 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|