About 7H-benzo[c]fluorene
7H-benzo[c]fluorene (PubChem CID 9150) has the molecular formula C17H12
and a molecular weight of 216.28 g/mol. Its IUPAC name is 7H-benzo[c]fluorene.
Molecular Properties
| Compound Name | 7H-benzo[c]fluorene |
| PubChem CID | 9150 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 7H-benzo[c]fluorene |
| SMILES | c1ccc2c(c1)Cc1ccc3ccccc3c1-2 |
| InChI | InChI=1S/C17H12/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2 |
| InChIKey | FRIJWEQBTIZQMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7H-benzo[c]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[c]fluorene?
The IUPAC name of 7H-benzo[c]fluorene (CID 9150) is 7H-benzo[c]fluorene.
What is the SMILES notation for 7H-benzo[c]fluorene?
The canonical SMILES for 7H-benzo[c]fluorene is c1ccc2c(c1)Cc1ccc3ccccc3c1-2.
What is the InChIKey of 7H-benzo[c]fluorene?
The InChIKey is FRIJWEQBTIZQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2.
What are the key properties of 7H-benzo[c]fluorene?
7H-benzo[c]fluorene has a molecular weight of 216.28 g/mol, XLogP of 4.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[c]fluorene is sourced from PubChem (CID 9150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).