C11H9ClF6N2S — CID 91500019
[2-chloro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-(2,2,2-trifluoroethyl)diazene (PubChem CID 91500019) has the molecular formula C11H9ClF6N2S and a molecular weight of 350.72 g/mol. Its IUPAC name is [2-chloro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-(2,2,2-trifluoroethyl)diazene.
| Compound Name | [2-chloro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-(2,2,2-trifluoroethyl)diazene |
|---|---|
| PubChem CID | 91500019 |
| Molecular Formula | C11H9ClF6N2S |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | [2-chloro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-(2,2,2-trifluoroethyl)diazene |
| SMILES | Cc1cc(Cl)c(/N=N/CC(F)(F)F)cc1SCC(F)(F)F |
| InChI | InChI=1S/C11H9ClF6N2S/c1-6-2-7(12)8(20-19-4-10(13,14)15)3-9(6)21-5-11(16,17)18/h2-3H,4-5H2,1H3/b20-19+ |
| InChIKey | LNPBSKYQMUIUTK-FMQUCBEESA-N |
| XLogP | 5.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|