C21H24ClN3O3 — CID 91500077
4-(2-amino-2-oxoethyl)-1-[[3-(2-chlorophenoxy)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 91500077) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethyl)-1-[[3-(2-chlorophenoxy)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 4-(2-amino-2-oxoethyl)-1-[[3-(2-chlorophenoxy)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91500077 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-(2-amino-2-oxoethyl)-1-[[3-(2-chlorophenoxy)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)CC1(C(N)=O)CCN(Cc2cccc(Oc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C21H24ClN3O3/c22-17-6-1-2-7-18(17)28-16-5-3-4-15(12-16)14-25-10-8-21(9-11-25,20(24)27)13-19(23)26/h1-7,12H,8-11,13-14H2,(H2,23,26)(H2,24,27) |
| InChIKey | YDNZFBHCUXBNMS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |