About 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline
4,9-dihydro-2H-pyrrolo[3,4-b]quinoline (PubChem CID 91500858) has the molecular formula C11H10N2
and a molecular weight of 170.22 g/mol. Its IUPAC name is 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline |
| PubChem CID | 91500858 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline |
| SMILES | c1ccc2c(c1)Cc1c[nH]cc1N2 |
| InChI | InChI=1S/C11H10N2/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)13-10/h1-4,6-7,12-13H,5H2 |
| InChIKey | SLOJWIMEJILBET-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline?
The IUPAC name of 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline (CID 91500858) is 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline.
What is the SMILES notation for 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline?
The canonical SMILES for 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline is c1ccc2c(c1)Cc1c[nH]cc1N2.
What is the InChIKey of 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline?
The InChIKey is SLOJWIMEJILBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-4-10-8(3-1)5-9-6-12-7-11(9)13-10/h1-4,6-7,12-13H,5H2.
What are the key properties of 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline?
4,9-dihydro-2H-pyrrolo[3,4-b]quinoline has a molecular weight of 170.22 g/mol, XLogP of 2.66, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dihydro-2H-pyrrolo[3,4-b]quinoline is sourced from PubChem (CID 91500858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).