C18H32O4 — CID 91501215
(1-ethoxy-1-oxopropan-2-yl) 4,4,8,8-tetramethylnon-5-enoate (PubChem CID 91501215) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 4,4,8,8-tetramethylnon-5-enoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 4,4,8,8-tetramethylnon-5-enoate |
|---|---|
| PubChem CID | 91501215 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 4,4,8,8-tetramethylnon-5-enoate |
| SMILES | CCOC(=O)C(C)OC(=O)CCC(C)(C)C=CCC(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-8-21-16(20)14(2)22-15(19)10-13-18(6,7)12-9-11-17(3,4)5/h9,12,14H,8,10-11,13H2,1-7H3 |
| InChIKey | OXKJSEQIXMSJIS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|