C12H16ClF3N2O — CID 91501232
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]hexan-3-ol (PubChem CID 91501232) has the molecular formula C12H16ClF3N2O and a molecular weight of 296.72 g/mol. Its IUPAC name is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]hexan-3-ol.
| Compound Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]hexan-3-ol |
|---|---|
| PubChem CID | 91501232 |
| Molecular Formula | C12H16ClF3N2O |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]hexan-3-ol |
| SMILES | CCCC(O)CCNc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C12H16ClF3N2O/c1-2-3-8(19)6-7-17-10-5-4-9(11(13)18-10)12(14,15)16/h4-5,8,19H,2-3,6-7H2,1H3,(H,17,18) |
| InChIKey | QTYQSDGFRMWJIG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|