C11H18FNS — CID 91501351
6-fluoro-3-propyl-1-sulfanyl-2,3,8,9-tetrahydroazonine (PubChem CID 91501351) has the molecular formula C11H18FNS and a molecular weight of 215.34 g/mol. Its IUPAC name is 6-fluoro-3-propyl-1-sulfanyl-2,3,8,9-tetrahydroazonine.
| Compound Name | 6-fluoro-3-propyl-1-sulfanyl-2,3,8,9-tetrahydroazonine |
|---|---|
| PubChem CID | 91501351 |
| Molecular Formula | C11H18FNS |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 6-fluoro-3-propyl-1-sulfanyl-2,3,8,9-tetrahydroazonine |
| SMILES | CCCC1C=CC(F)=CCCN(S)C1 |
| InChI | InChI=1S/C11H18FNS/c1-2-4-10-6-7-11(12)5-3-8-13(14)9-10/h5-7,10,14H,2-4,8-9H2,1H3 |
| InChIKey | NCDZXFHOHYNULQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|