C25H21F4N7OS — CID 91501353
6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[3-thiophen-2-yl-5-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 91501353) has the molecular formula C25H21F4N7OS and a molecular weight of 543.55 g/mol. Its IUPAC name is 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[3-thiophen-2-yl-5-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[3-thiophen-2-yl-5-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91501353 |
| Molecular Formula | C25H21F4N7OS |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[3-thiophen-2-yl-5-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | Fc1cnc(/N=N/Cc2ccc(Nc3cc(-c4cccs4)cc(C(F)(F)F)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C25H21F4N7OS/c26-21-15-31-24(34-23(21)36-5-7-37-8-6-36)35-32-14-18-3-4-19(13-30-18)33-20-11-16(22-2-1-9-38-22)10-17(12-20)25(27,28)29/h1-4,9-13,15,33H,5-8,14H2/b35-32+ |
| InChIKey | QZGVGBUMPMLSSL-LVYIWIAJSA-N |
| XLogP | 6.62 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|