C23H29N3O3S — CID 9150147
N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 9150147) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9150147 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(N[C@H](CN1CCOCC1)c1ccccc1)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C23H29N3O3S/c27-22(19-8-10-26(11-9-19)23(28)21-7-4-16-30-21)24-20(18-5-2-1-3-6-18)17-25-12-14-29-15-13-25/h1-7,16,19-20H,8-15,17H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | USWYXXFJQCTYPQ-HXUWFJFHSA-N |
| XLogP | 2.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |