C32H40N6O5 — CID 91502554
pyrrolidin-1-yl N-[(3S)-6,6-dimethyl-3-(5-methyl-2-phenyltriazole-4-carbonyl)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 91502554) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is pyrrolidin-1-yl N-[(3S)-6,6-dimethyl-3-(5-methyl-2-phenyltriazole-4-carbonyl)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | pyrrolidin-1-yl N-[(3S)-6,6-dimethyl-3-(5-methyl-2-phenyltriazole-4-carbonyl)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 91502554 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | pyrrolidin-1-yl N-[(3S)-6,6-dimethyl-3-(5-methyl-2-phenyltriazole-4-carbonyl)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)[C@](CCC(C)(C)C)(NC(=O)ON1CCCC1)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C32H40N6O5/c1-22(24-14-8-6-9-15-24)33-29(41)28(40)32(19-18-31(3,4)5,34-30(42)43-37-20-12-13-21-37)27(39)26-23(2)35-38(36-26)25-16-10-7-11-17-25/h6-11,14-17,22H,12-13,18-21H2,1-5H3,(H,33,41)(H,34,42)/t22-,32+/m1/s1 |
| InChIKey | OHGDQMSMFZSGJH-KCEHZKJRSA-N |
| XLogP | 4.51 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|