C11H18N4+2 — CID 91502560
2-(1,3-dimethylimidazol-1-ium-2-yl)-1-ethyl-3-methylimidazol-3-ium (PubChem CID 91502560) has the molecular formula C11H18N4+2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(1,3-dimethylimidazol-1-ium-2-yl)-1-ethyl-3-methylimidazol-3-ium.
| Compound Name | 2-(1,3-dimethylimidazol-1-ium-2-yl)-1-ethyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 91502560 |
| Molecular Formula | C11H18N4+2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(1,3-dimethylimidazol-1-ium-2-yl)-1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1-c1n(C)cc[n+]1C |
| InChI | InChI=1S/C11H18N4/c1-5-15-9-8-14(4)11(15)10-12(2)6-7-13(10)3/h6-9H,5H2,1-4H3/q+2 |
| InChIKey | XLXYOCMOYFVXPU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|