C13H11Cl2NO3 — CID 9150272
4',7'-dichloro-1'-prop-2-enylspiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 9150272) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 4',7'-dichloro-1'-prop-2-enylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 4',7'-dichloro-1'-prop-2-enylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9150272 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 4',7'-dichloro-1'-prop-2-enylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)C2(OCCO2)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C13H11Cl2NO3/c1-2-5-16-11-9(15)4-3-8(14)10(11)13(12(16)17)18-6-7-19-13/h2-4H,1,5-7H2 |
| InChIKey | SXKQOCSZYAPLTQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|