About 6-hydroxyhexyl N-propylidenecarbamate
6-hydroxyhexyl N-propylidenecarbamate (PubChem CID 91503077) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-hydroxyhexyl N-propylidenecarbamate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl N-propylidenecarbamate |
| PubChem CID | 91503077 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 6-hydroxyhexyl N-propylidenecarbamate |
| SMILES | CCC=NC(=O)OCCCCCCO |
| InChI | InChI=1S/C10H19NO3/c1-2-7-11-10(13)14-9-6-4-3-5-8-12/h7,12H,2-6,8-9H2,1H3 |
| InChIKey | WIAPIHWFFRQFNQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl N-propylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl N-propylidenecarbamate?
The IUPAC name of 6-hydroxyhexyl N-propylidenecarbamate (CID 91503077) is 6-hydroxyhexyl N-propylidenecarbamate.
What is the SMILES notation for 6-hydroxyhexyl N-propylidenecarbamate?
The canonical SMILES for 6-hydroxyhexyl N-propylidenecarbamate is CCC=NC(=O)OCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl N-propylidenecarbamate?
The InChIKey is WIAPIHWFFRQFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-7-11-10(13)14-9-6-4-3-5-8-12/h7,12H,2-6,8-9H2,1H3.
What are the key properties of 6-hydroxyhexyl N-propylidenecarbamate?
6-hydroxyhexyl N-propylidenecarbamate has a molecular weight of 201.27 g/mol, XLogP of 2.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl N-propylidenecarbamate is sourced from PubChem (CID 91503077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).