C22H30N4O5 — CID 91503111
[(1S,2S)-2-(hydroxycarbamoyl)cyclopropyl]-[4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]carbamic acid (PubChem CID 91503111) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is [(1S,2S)-2-(hydroxycarbamoyl)cyclopropyl]-[4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]carbamic acid.
| Compound Name | [(1S,2S)-2-(hydroxycarbamoyl)cyclopropyl]-[4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 91503111 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(1S,2S)-2-(hydroxycarbamoyl)cyclopropyl]-[4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]carbamic acid |
| SMILES | O=C(NO)[C@H]1C[C@@H]1N(C(=O)O)C1CCC(C(=O)N2CCN(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H30N4O5/c27-20(23-31)18-14-19(18)26(22(29)30)17-8-6-15(7-9-17)21(28)25-12-10-24(11-13-25)16-4-2-1-3-5-16/h1-5,15,17-19,31H,6-14H2,(H,23,27)(H,29,30)/t15?,17?,18-,19-/m0/s1 |
| InChIKey | STHQYLACFJZPSD-FYOYPEGLSA-N |
| XLogP | 1.77 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|