About methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene
methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene (PubChem CID 91503823) has the molecular formula C14H25NO5S
and a molecular weight of 319.42 g/mol. Its IUPAC name is methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene.
Molecular Properties
| Compound Name | methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene |
| PubChem CID | 91503823 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene |
| SMILES | CN1CCC(O)(O)CC1.CO.CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O2S.C6H13NO2.CH4O/c1-10(8,9)7-5-3-2-4-6-7;1-7-4-2-6(8,9)3-5-7;1-2/h2-6H,1H3;8-9H,2-5H2,1H3;2H,1H3 |
| InChIKey | ZROOVDFEYBIGLZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene?
The IUPAC name of methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene (CID 91503823) is methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene.
What is the SMILES notation for methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene?
The canonical SMILES for methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene is CN1CCC(O)(O)CC1.CO.CS(=O)(=O)c1ccccc1.
What is the InChIKey of methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene?
The InChIKey is ZROOVDFEYBIGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.C6H13NO2.CH4O/c1-10(8,9)7-5-3-2-4-6-7;1-7-4-2-6(8,9)3-5-7;1-2/h2-6H,1H3;8-9H,2-5H2,1H3;2H,1H3.
What are the key properties of methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene?
methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene has a molecular weight of 319.42 g/mol, XLogP of 0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1-methylpiperidine-4,4-diol;methylsulfonylbenzene is sourced from PubChem (CID 91503823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).