About CID 91504124
CID 91504124 (PubChem CID 91504124) has the molecular formula C11H17BNO2S
and a molecular weight of 238.14 g/mol.
Molecular Properties
| Compound Name | CID 91504124 |
| PubChem CID | 91504124 |
| Molecular Formula | C11H17BNO2S |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C(C)(C)CO)c1O.[B]=NS |
| InChI | InChI=1S/C11H16O2.BHNS/c1-8-5-4-6-9(10(8)13)11(2,3)7-12;1-2-3/h4-6,12-13H,7H2,1-3H3;3H |
| InChIKey | UDMPNMDIZOHNQP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 91504124 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91504124?
The IUPAC name of CID 91504124 (CID 91504124) is not available.
What is the SMILES notation for CID 91504124?
The canonical SMILES for CID 91504124 is Cc1cccc(C(C)(C)CO)c1O.[B]=NS.
What is the InChIKey of CID 91504124?
The InChIKey is UDMPNMDIZOHNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.BHNS/c1-8-5-4-6-9(10(8)13)11(2,3)7-12;1-2-3/h4-6,12-13H,7H2,1-3H3;3H.
What are the key properties of CID 91504124?
CID 91504124 has a molecular weight of 238.14 g/mol, XLogP of 2.15, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91504124 is sourced from PubChem (CID 91504124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).