C14H7F3N2O2 — CID 91504246
4-hydroxy-3-(2,4,6-trifluorophenyl)-1H-1,5-naphthyridin-2-one (PubChem CID 91504246) has the molecular formula C14H7F3N2O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 4-hydroxy-3-(2,4,6-trifluorophenyl)-1H-1,5-naphthyridin-2-one.
| Compound Name | 4-hydroxy-3-(2,4,6-trifluorophenyl)-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 91504246 |
| Molecular Formula | C14H7F3N2O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 4-hydroxy-3-(2,4,6-trifluorophenyl)-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2c(O)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H7F3N2O2/c15-6-4-7(16)10(8(17)5-6)11-13(20)12-9(19-14(11)21)2-1-3-18-12/h1-5H,(H2,19,20,21) |
| InChIKey | LJHUZVBZDBJTFT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |