C30H35N3O2 — CID 91505535
(8R,9S,13S,14S)-3-hydroxy-13-methyl-2-[3-[4-(4-methylphenyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 91505535) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-[3-[4-(4-methylphenyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-[3-[4-(4-methylphenyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91505535 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-[3-[4-(4-methylphenyl)triazol-1-yl]propyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1ccc(-c2cn(CCCc3cc4c(cc3O)CC[C@@H]3[C@@H]4CC[C@]4(C)C(=O)CC[C@@H]34)nn2)cc1 |
| InChI | InChI=1S/C30H35N3O2/c1-19-5-7-20(8-6-19)27-18-33(32-31-27)15-3-4-22-16-25-21(17-28(22)34)9-10-24-23(25)13-14-30(2)26(24)11-12-29(30)35/h5-8,16-18,23-24,26,34H,3-4,9-15H2,1-2H3/t23-,24+,26-,30-/m0/s1 |
| InChIKey | SGYILWKQJNWHIM-LWYAIONJSA-N |
| XLogP | 6.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |