About 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine
2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine (PubChem CID 91505689) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine |
| PubChem CID | 91505689 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine |
| SMILES | CCCN(CCC)c1ncc(N)s1 |
| InChI | InChI=1S/C9H17N3S/c1-3-5-12(6-4-2)9-11-7-8(10)13-9/h7H,3-6,10H2,1-2H3 |
| InChIKey | XYDXLZNQKHEOCT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine?
The IUPAC name of 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine (CID 91505689) is 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine.
What is the SMILES notation for 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine?
The canonical SMILES for 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine is CCCN(CCC)c1ncc(N)s1.
What is the InChIKey of 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine?
The InChIKey is XYDXLZNQKHEOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-3-5-12(6-4-2)9-11-7-8(10)13-9/h7H,3-6,10H2,1-2H3.
What are the key properties of 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine?
2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine has a molecular weight of 199.32 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dipropyl-1,3-thiazole-2,5-diamine is sourced from PubChem (CID 91505689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).