C38H40N6O2+2 — CID 91505753
[(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]methyl-[[4-[(Z)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]quinolin-1-ium-1-yl]methyl]-dimethylazanium (PubChem CID 91505753) has the molecular formula C38H40N6O2+2 and a molecular weight of 612.78 g/mol. Its IUPAC name is [(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]methyl-[[4-[(Z)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]quinolin-1-ium-1-yl]methyl]-dimethylazanium.
| Compound Name | [(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]methyl-[[4-[(Z)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]quinolin-1-ium-1-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 91505753 |
| Molecular Formula | C38H40N6O2+2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | [(4-amino-3-methyl-9,10-dioxoanthracen-1-yl)amino]methyl-[[4-[(Z)-N-(N,4-dimethylanilino)-C-methylcarbonimidoyl]quinolin-1-ium-1-yl]methyl]-dimethylazanium |
| SMILES | C/C(=N/N(C)c1ccc(C)cc1)c1cc[n+](C[N+](C)(C)CNc2cc(C)c(N)c3c2C(=O)c2ccccc2C3=O)c2ccccc12 |
| InChI | InChI=1S/C38H39N6O2/c1-24-15-17-27(18-16-24)42(4)41-26(3)28-19-20-43(33-14-10-9-11-29(28)33)23-44(5,6)22-40-32-21-25(2)36(39)35-34(32)37(45)30-12-7-8-13-31(30)38(35)46/h7-21,39,41H,22-23H2,1-6H3/q+1/p+1 |
| InChIKey | UUEPXJNAUWJFCV-UHFFFAOYSA-O |
| XLogP | 6.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|