(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid

C23H39NO2 — CID 91505807

IUPAC(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid
SMILESCCCCCC=CCC=CCC=CCC=CCCCCN[C@H](C)C(=O)O
InChIInChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22(2)23(25)26/h7-8,10-11,13-14,16-17,22,24H,3-6,9,12,15,18-21H2,1-2H3,(H,25,26)/t22-/m1/s1
InChIKeyZMBYGVKXTACGHR-JOCHJYFZSA-N
MW361.57 g/mol
LogP6.19
Rot. Bonds17

About (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid

(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid (PubChem CID 91505807) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid
PubChem CID91505807
Molecular FormulaC23H39NO2
Molecular Weight361.57 g/mol
Exact Mass361.30
IUPAC Name(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid
SMILESCCCCCC=CCC=CCC=CCC=CCCCCN[C@H](C)C(=O)O
InChIInChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22(2)23(25)26/h7-8,10-11,13-14,16-17,22,24H,3-6,9,12,15,18-21H2,1-2H3,(H,25,26)/t22-/m1/s1
InChIKeyZMBYGVKXTACGHR-JOCHJYFZSA-N
XLogP6.19
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500361.57
LogP ≤ 56.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid?
The IUPAC name of (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid (CID 91505807) is (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid.
What is the SMILES notation for (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid?
The canonical SMILES for (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid is CCCCCC=CCC=CCC=CCC=CCCCCN[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid?
The InChIKey is ZMBYGVKXTACGHR-JOCHJYFZSA-N. The full InChI is InChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22(2)23(25)26/h7-8,10-11,13-14,16-17,22,24H,3-6,9,12,15,18-21H2,1-2H3,(H,25,26)/t22-/m1/s1.
What are the key properties of (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid?
(2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid has a molecular weight of 361.57 g/mol, XLogP of 6.19, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid is sourced from PubChem (CID 91505807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).