C34H46N6O — CID 91506056
3-[1-cyclohexyl-4-[cyclohexyl(1H-pyrazol-4-ylmethyl)amino]butyl]-6-phenoxy-4H-quinazolin-2-amine (PubChem CID 91506056) has the molecular formula C34H46N6O and a molecular weight of 554.78 g/mol. Its IUPAC name is 3-[1-cyclohexyl-4-[cyclohexyl(1H-pyrazol-4-ylmethyl)amino]butyl]-6-phenoxy-4H-quinazolin-2-amine.
| Compound Name | 3-[1-cyclohexyl-4-[cyclohexyl(1H-pyrazol-4-ylmethyl)amino]butyl]-6-phenoxy-4H-quinazolin-2-amine |
|---|---|
| PubChem CID | 91506056 |
| Molecular Formula | C34H46N6O |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 3-[1-cyclohexyl-4-[cyclohexyl(1H-pyrazol-4-ylmethyl)amino]butyl]-6-phenoxy-4H-quinazolin-2-amine |
| SMILES | NC1=Nc2ccc(Oc3ccccc3)cc2CN1C(CCCN(Cc1cn[nH]c1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C34H46N6O/c35-34-38-32-19-18-31(41-30-15-8-3-9-16-30)21-28(32)25-40(34)33(27-11-4-1-5-12-27)17-10-20-39(24-26-22-36-37-23-26)29-13-6-2-7-14-29/h3,8-9,15-16,18-19,21-23,27,29,33H,1-2,4-7,10-14,17,20,24-25H2,(H2,35,38)(H,36,37) |
| InChIKey | KAUDLRCGXARMGS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |