About 6-iodo-1H-pyrazolo[3,4-d]pyrimidine
6-iodo-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 91507091) has the molecular formula C5H3IN4
and a molecular weight of 246.01 g/mol. Its IUPAC name is 6-iodo-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-iodo-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 91507091 |
| Molecular Formula | C5H3IN4 |
| Molecular Weight | 246.01 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 6-iodo-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | Ic1ncc2cn[nH]c2n1 |
| InChI | InChI=1S/C5H3IN4/c6-5-7-1-3-2-8-10-4(3)9-5/h1-2H,(H,7,8,9,10) |
| InChIKey | LJFHZVVZARUSGY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.01 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 6-iodo-1H-pyrazolo[3,4-d]pyrimidine (CID 91507091) is 6-iodo-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 6-iodo-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 6-iodo-1H-pyrazolo[3,4-d]pyrimidine is Ic1ncc2cn[nH]c2n1.
What is the InChIKey of 6-iodo-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is LJFHZVVZARUSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3IN4/c6-5-7-1-3-2-8-10-4(3)9-5/h1-2H,(H,7,8,9,10).
What are the key properties of 6-iodo-1H-pyrazolo[3,4-d]pyrimidine?
6-iodo-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 246.01 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 91507091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).