C13H12N2O5S — CID 91508046
4-[2,4-dioxo-5-[(6-oxo-1H-pyridin-3-yl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 91508046) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-[2,4-dioxo-5-[(6-oxo-1H-pyridin-3-yl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[2,4-dioxo-5-[(6-oxo-1H-pyridin-3-yl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 91508046 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[2,4-dioxo-5-[(6-oxo-1H-pyridin-3-yl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)SC(=Cc2ccc(=O)[nH]c2)C1=O |
| InChI | InChI=1S/C13H12N2O5S/c16-10-4-3-8(7-14-10)6-9-12(19)15(13(20)21-9)5-1-2-11(17)18/h3-4,6-7H,1-2,5H2,(H,14,16)(H,17,18) |
| InChIKey | COFFAPRDZHWXMZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|