About (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine
(E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine (PubChem CID 91508740) has the molecular formula C19H34N3-
and a molecular weight of 304.50 g/mol. Its IUPAC name is (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine.
Molecular Properties
| Compound Name | (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine |
| PubChem CID | 91508740 |
| Molecular Formula | C19H34N3- |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine |
| SMILES | C=CCC(C=C)CN/C=C(\[CH-]C)CCCC(C)CNC(=C)N |
| InChI | InChI=1S/C19H34N3/c1-6-10-18(7-2)14-21-15-19(8-3)12-9-11-16(4)13-22-17(5)20/h6-8,15-16,18,21-22H,1-2,5,9-14,20H2,3-4H3/q-1/b19-15+ |
| InChIKey | FTEJUFILZZCVSS-XDJHFCHBSA-N |
| XLogP | 3.89 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine?
The IUPAC name of (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine (CID 91508740) is (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine.
What is the SMILES notation for (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine?
The canonical SMILES for (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine is C=CCC(C=C)CN/C=C(\[CH-]C)CCCC(C)CNC(=C)N.
What is the InChIKey of (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine?
The InChIKey is FTEJUFILZZCVSS-XDJHFCHBSA-N. The full InChI is InChI=1S/C19H34N3/c1-6-10-18(7-2)14-21-15-19(8-3)12-9-11-16(4)13-22-17(5)20/h6-8,15-16,18,21-22H,1-2,5,9-14,20H2,3-4H3/q-1/b19-15+.
What are the key properties of (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine?
(E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine has a molecular weight of 304.50 g/mol, XLogP of 3.89, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(1-aminoethenyl)-N-(2-ethenylpent-4-enyl)-2-ethyl-6-methylhept-1-ene-1,7-diamine is sourced from PubChem (CID 91508740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).