C14H17NO2S2 — CID 91509000
1-(3a,6a-dihydrothieno[3,2-b]thiophen-5-yl)-2-(1-pyrrolidin-2-ylethenoxy)ethanone (PubChem CID 91509000) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-(3a,6a-dihydrothieno[3,2-b]thiophen-5-yl)-2-(1-pyrrolidin-2-ylethenoxy)ethanone.
| Compound Name | 1-(3a,6a-dihydrothieno[3,2-b]thiophen-5-yl)-2-(1-pyrrolidin-2-ylethenoxy)ethanone |
|---|---|
| PubChem CID | 91509000 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(3a,6a-dihydrothieno[3,2-b]thiophen-5-yl)-2-(1-pyrrolidin-2-ylethenoxy)ethanone |
| SMILES | C=C(OCC(=O)C1=CC2SC=CC2S1)C1CCCN1 |
| InChI | InChI=1S/C14H17NO2S2/c1-9(10-3-2-5-15-10)17-8-11(16)13-7-14-12(19-13)4-6-18-14/h4,6-7,10,12,14-15H,1-3,5,8H2 |
| InChIKey | KVJVWGNNDJNKII-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|