About 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol
2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol (PubChem CID 91509042) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol |
| PubChem CID | 91509042 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)C(O)C(C)C1.N#CCC(=O)O |
| InChI | InChI=1S/C9H18O.C3H3NO2/c1-6-4-7(2)9(10)8(3)5-6;4-2-1-3(5)6/h6-10H,4-5H2,1-3H3;1H2,(H,5,6) |
| InChIKey | LFNQWMLWRYSSBK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol?
The IUPAC name of 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol (CID 91509042) is 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol.
What is the SMILES notation for 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol?
The canonical SMILES for 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol is CC1CC(C)C(O)C(C)C1.N#CCC(=O)O.
What is the InChIKey of 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol?
The InChIKey is LFNQWMLWRYSSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C3H3NO2/c1-6-4-7(2)9(10)8(3)5-6;4-2-1-3(5)6/h6-10H,4-5H2,1-3H3;1H2,(H,5,6).
What are the key properties of 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol?
2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol has a molecular weight of 227.30 g/mol, XLogP of 2.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetic acid;2,4,6-trimethylcyclohexan-1-ol is sourced from PubChem (CID 91509042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).