C16H21N3O6 — CID 91509135
N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(1,1-dihydroxybut-2-ynoxy)benzamide (PubChem CID 91509135) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(1,1-dihydroxybut-2-ynoxy)benzamide.
| Compound Name | N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(1,1-dihydroxybut-2-ynoxy)benzamide |
|---|---|
| PubChem CID | 91509135 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-(1,1-dihydroxybut-2-ynoxy)benzamide |
| SMILES | CC#CC(O)(O)Oc1ccc(C(=O)NC(C(=O)NO)C(C)(C)N)cc1 |
| InChI | InChI=1S/C16H21N3O6/c1-4-9-16(22,23)25-11-7-5-10(6-8-11)13(20)18-12(14(21)19-24)15(2,3)17/h5-8,12,22-24H,17H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | PNMPMKJURMQVLH-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|