C32H44O11 — CID 91509195
[2-[(3,5-dihydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate;[2-[(3-hydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 91509195) has the molecular formula C32H44O11 and a molecular weight of 604.69 g/mol. Its IUPAC name is [2-[(3,5-dihydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate;[2-[(3-hydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(3,5-dihydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate;[2-[(3-hydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 91509195 |
| Molecular Formula | C32H44O11 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | [2-[(3,5-dihydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate;[2-[(3-hydroxy-2-methyl-1-adamantyl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC12CC3CC(CC(O)(C3)C1C)C2.C=CC(=O)OCC(=O)OC12CC3CC(O)(CC(O)(C3)C1C)C2 |
| InChI | InChI=1S/C16H22O6.C16H22O5/c1-3-12(17)21-7-13(18)22-16-6-11-4-14(19,9-16)8-15(20,5-11)10(16)2;1-3-13(17)20-9-14(18)21-16-7-11-4-12(8-16)6-15(19,5-11)10(16)2/h3,10-11,19-20H,1,4-9H2,2H3;3,10-12,19H,1,4-9H2,2H3 |
| InChIKey | QSYUKIFHXHADTG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|