C13H14N8O4 — CID 91509204
9-(1,7-dimethyl-2,6-dioxo-3,8-dihydropurin-9-yl)-3-methylpurine-2,6-dione (PubChem CID 91509204) has the molecular formula C13H14N8O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 9-(1,7-dimethyl-2,6-dioxo-3,8-dihydropurin-9-yl)-3-methylpurine-2,6-dione.
| Compound Name | 9-(1,7-dimethyl-2,6-dioxo-3,8-dihydropurin-9-yl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 91509204 |
| Molecular Formula | C13H14N8O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 9-(1,7-dimethyl-2,6-dioxo-3,8-dihydropurin-9-yl)-3-methylpurine-2,6-dione |
| SMILES | CN1CN(n2cnc3c(=O)[nH]c(=O)n(C)c32)c2[nH]c(=O)n(C)c(=O)c21 |
| InChI | InChI=1S/C13H14N8O4/c1-17-5-21(8-7(17)11(23)19(3)12(24)15-8)20-4-14-6-9(22)16-13(25)18(2)10(6)20/h4H,5H2,1-3H3,(H,15,24)(H,16,22,25) |
| InChIKey | NQDZQGWBUYMVSB-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |