C65H60N4O11 — CID 91509351
bis(1-[4-[(4-acetylphenyl)diazenyl]phenyl]-3-methoxypropan-1-one);[4-[4-(4-methoxybenzoyl)phenyl]phenyl] 4-ethoxybenzoate (PubChem CID 91509351) has the molecular formula C65H60N4O11 and a molecular weight of 1073.21 g/mol. Its IUPAC name is bis(1-[4-[(4-acetylphenyl)diazenyl]phenyl]-3-methoxypropan-1-one);[4-[4-(4-methoxybenzoyl)phenyl]phenyl] 4-ethoxybenzoate.
| Compound Name | bis(1-[4-[(4-acetylphenyl)diazenyl]phenyl]-3-methoxypropan-1-one);[4-[4-(4-methoxybenzoyl)phenyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 91509351 |
| Molecular Formula | C65H60N4O11 |
| Molecular Weight | 1073.21 g/mol |
| Exact Mass | 1072.43 |
| IUPAC Name | bis(1-[4-[(4-acetylphenyl)diazenyl]phenyl]-3-methoxypropan-1-one);[4-[4-(4-methoxybenzoyl)phenyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)c4ccc(OC)cc4)cc3)cc2)cc1.COCCC(=O)c1ccc(/N=N/c2ccc(C(C)=O)cc2)cc1.COCCC(=O)c1ccc(/N=N/c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C29H24O5.2C18H18N2O3/c1-3-33-26-16-12-24(13-17-26)29(31)34-27-18-8-21(9-19-27)20-4-6-22(7-5-20)28(30)23-10-14-25(32-2)15-11-23;2*1-13(21)14-3-7-16(8-4-14)19-20-17-9-5-15(6-10-17)18(22)11-12-23-2/h4-19H,3H2,1-2H3;2*3-10H,11-12H2,1-2H3/b;2*20-19+ |
| InChIKey | VDLVMHIHMIVUIY-NGTXTIOBSA-N |
| XLogP | 15.26 |
| TPSA | 198.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.21 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|