About 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole
5-methoxy-2-propyl-3a,7a-dihydro-3H-indole (PubChem CID 91509436) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole.
Molecular Properties
| Compound Name | 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole |
| PubChem CID | 91509436 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole |
| SMILES | CCCC1=NC2C=CC(OC)=CC2C1 |
| InChI | InChI=1S/C12H17NO/c1-3-4-10-7-9-8-11(14-2)5-6-12(9)13-10/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | WBJGDLZUMRSZPJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole?
The IUPAC name of 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole (CID 91509436) is 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole.
What is the SMILES notation for 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole?
The canonical SMILES for 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole is CCCC1=NC2C=CC(OC)=CC2C1.
What is the InChIKey of 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole?
The InChIKey is WBJGDLZUMRSZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-3-4-10-7-9-8-11(14-2)5-6-12(9)13-10/h5-6,8-9,12H,3-4,7H2,1-2H3.
What are the key properties of 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole?
5-methoxy-2-propyl-3a,7a-dihydro-3H-indole has a molecular weight of 191.27 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-propyl-3a,7a-dihydro-3H-indole is sourced from PubChem (CID 91509436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).