C38H78 — CID 91509924
12-heptyl-11-hexyl-2,3,3,4,11,12-hexamethylnonadecane (PubChem CID 91509924) has the molecular formula C38H78 and a molecular weight of 535.04 g/mol. Its IUPAC name is 12-heptyl-11-hexyl-2,3,3,4,11,12-hexamethylnonadecane.
| Compound Name | 12-heptyl-11-hexyl-2,3,3,4,11,12-hexamethylnonadecane |
|---|---|
| PubChem CID | 91509924 |
| Molecular Formula | C38H78 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.61 |
| IUPAC Name | 12-heptyl-11-hexyl-2,3,3,4,11,12-hexamethylnonadecane |
| SMILES | CCCCCCCC(C)(CCCCCCC)C(C)(CCCCCC)CCCCCCC(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C38H78/c1-11-14-17-21-26-31-38(10,32-27-22-18-15-12-2)37(9,30-25-19-16-13-3)33-28-23-20-24-29-35(6)36(7,8)34(4)5/h34-35H,11-33H2,1-10H3 |
| InChIKey | HXOKERPKJRFJRY-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|