About 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine
2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine (PubChem CID 91510004) has the molecular formula C18H31N5O4
and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine.
Molecular Properties
| Compound Name | 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine |
| PubChem CID | 91510004 |
| Molecular Formula | C18H31N5O4 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine |
| SMILES | CCCCOc1nc(N)c2c(n1)N(CCOCC1CCOCC1)C(OC)N2 |
| InChI | InChI=1S/C18H31N5O4/c1-3-4-8-27-17-21-15(19)14-16(22-17)23(18(20-14)24-2)7-11-26-12-13-5-9-25-10-6-13/h13,18,20H,3-12H2,1-2H3,(H2,19,21,22) |
| InChIKey | JPFGHPILHSSUIH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine?
The IUPAC name of 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine (CID 91510004) is 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine.
What is the SMILES notation for 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine?
The canonical SMILES for 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine is CCCCOc1nc(N)c2c(n1)N(CCOCC1CCOCC1)C(OC)N2.
What is the InChIKey of 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine?
The InChIKey is JPFGHPILHSSUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N5O4/c1-3-4-8-27-17-21-15(19)14-16(22-17)23(18(20-14)24-2)7-11-26-12-13-5-9-25-10-6-13/h13,18,20H,3-12H2,1-2H3,(H2,19,21,22).
What are the key properties of 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine?
2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine has a molecular weight of 381.48 g/mol, XLogP of 1.84, 10 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-8-methoxy-9-[2-(oxan-4-ylmethoxy)ethyl]-7,8-dihydropurin-6-amine is sourced from PubChem (CID 91510004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).