About (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate
(2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate (PubChem CID 91510245) has the molecular formula C13H10F3NO5
and a molecular weight of 317.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate |
| PubChem CID | 91510245 |
| Molecular Formula | C13H10F3NO5 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate |
| SMILES | O=C(OCc1ccc(C(F)(F)F)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C13H10F3NO5/c14-13(15,16)9-3-1-8(2-4-9)7-21-12(20)22-17-10(18)5-6-11(17)19/h1-6,18-19H,7H2 |
| InChIKey | QWFLZFKNQHWIID-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate (CID 91510245) is (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate is O=C(OCc1ccc(C(F)(F)F)cc1)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate?
The InChIKey is QWFLZFKNQHWIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO5/c14-13(15,16)9-3-1-8(2-4-9)7-21-12(20)22-17-10(18)5-6-11(17)19/h1-6,18-19H,7H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate?
(2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate has a molecular weight of 317.22 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) [4-(trifluoromethyl)phenyl]methyl carbonate is sourced from PubChem (CID 91510245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).