C14H16N4 — CID 91510263
6-piperidin-4-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene (PubChem CID 91510263) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-piperidin-4-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene.
| Compound Name | 6-piperidin-4-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene |
|---|---|
| PubChem CID | 91510263 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-piperidin-4-yl-2,6,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),2,4(12),7,9-pentaene |
| SMILES | C1=Nc2nccc3c2=C1CN(C1CCNCC1)C=3 |
| InChI | InChI=1S/C14H16N4/c1-6-16-14-13-10(1)8-18(9-11(13)7-17-14)12-2-4-15-5-3-12/h1,6-8,12,15H,2-5,9H2 |
| InChIKey | DUHNWOAJOMYVPO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |