C22H32ClN5O3 — CID 91510828
3-[5-chloro-6-[[(3R)-1-[4-[(dimethylamino)methyl]cyclohexanecarbonyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 91510828) has the molecular formula C22H32ClN5O3 and a molecular weight of 449.98 g/mol. Its IUPAC name is 3-[5-chloro-6-[[(3R)-1-[4-[(dimethylamino)methyl]cyclohexanecarbonyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[5-chloro-6-[[(3R)-1-[4-[(dimethylamino)methyl]cyclohexanecarbonyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91510828 |
| Molecular Formula | C22H32ClN5O3 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-[5-chloro-6-[[(3R)-1-[4-[(dimethylamino)methyl]cyclohexanecarbonyl]pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | CN(C)CC1CCC(C(=O)N2CC[C@@H](Nc3ncc(C=CC(=O)NO)cc3Cl)C2)CC1 |
| InChI | InChI=1S/C22H32ClN5O3/c1-27(2)13-15-3-6-17(7-4-15)22(30)28-10-9-18(14-28)25-21-19(23)11-16(12-24-21)5-8-20(29)26-31/h5,8,11-12,15,17-18,31H,3-4,6-7,9-10,13-14H2,1-2H3,(H,24,25)(H,26,29)/t15?,17?,18-/m1/s1 |
| InChIKey | NTQRMXKIMBUWRP-VMWRSERWSA-N |
| XLogP | 2.63 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|