C25H31F3N4O2 — CID 91511083
2-(3-amino-2,4,6-trimethylanilino)-N-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]propanamide (PubChem CID 91511083) has the molecular formula C25H31F3N4O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-(3-amino-2,4,6-trimethylanilino)-N-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]propanamide.
| Compound Name | 2-(3-amino-2,4,6-trimethylanilino)-N-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 91511083 |
| Molecular Formula | C25H31F3N4O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-(3-amino-2,4,6-trimethylanilino)-N-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]propanamide |
| SMILES | Cc1cc(C)c(NC(C)C(=O)NC2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)c(C)c1N |
| InChI | InChI=1S/C25H31F3N4O2/c1-14-12-15(2)22(16(3)21(14)29)30-17(4)23(33)31-20-8-10-32(11-9-20)24(34)18-6-5-7-19(13-18)25(26,27)28/h5-7,12-13,17,20,30H,8-11,29H2,1-4H3,(H,31,33) |
| InChIKey | LGOXMEFNKMJJAV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|