C12H9F4N3S — CID 9151115
2,3,5,6-tetrafluoro-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]pyridin-4-amine (PubChem CID 9151115) has the molecular formula C12H9F4N3S and a molecular weight of 303.28 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]pyridin-4-amine |
|---|---|
| PubChem CID | 9151115 |
| Molecular Formula | C12H9F4N3S |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]pyridin-4-amine |
| SMILES | C/C(=N/Nc1c(F)c(F)nc(F)c1F)c1ccc(C)s1 |
| InChI | InChI=1S/C12H9F4N3S/c1-5-3-4-7(20-5)6(2)18-19-10-8(13)11(15)17-12(16)9(10)14/h3-4H,1-2H3,(H,17,19)/b18-6- |
| InChIKey | KFBYADJRDPJIPJ-FXBPXSCXSA-N |
| XLogP | 3.84 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|