About (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate
(5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate (PubChem CID 91511318) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 91511318 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2=CCC=CC2)C1 |
| InChI | InChI=1S/C17H26O2/c1-12(2)15-10-9-13(3)11-16(15)19-17(18)14-7-5-4-6-8-14/h4-5,8,12-13,15-16H,6-7,9-11H2,1-3H3 |
| InChIKey | PUGLDKCCNQUKON-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate (CID 91511318) is (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate is CC1CCC(C(C)C)C(OC(=O)C2=CCC=CC2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate?
The InChIKey is PUGLDKCCNQUKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-12(2)15-10-9-13(3)11-16(15)19-17(18)14-7-5-4-6-8-14/h4-5,8,12-13,15-16H,6-7,9-11H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate?
(5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate has a molecular weight of 262.39 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) cyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 91511318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).