C20H19ClN2O2 — CID 91511427
(1R,5S)-3-[5-(6-chloropyridazin-3-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91511427) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (1R,5S)-3-[5-(6-chloropyridazin-3-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[5-(6-chloropyridazin-3-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91511427 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (1R,5S)-3-[5-(6-chloropyridazin-3-yl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)nn2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C20H19ClN2O2/c1-2-11-3-4-12(16-7-8-17(21)23-22-16)10-15(11)18-19(24)13-5-6-14(9-13)20(18)25/h3-4,7-8,10,13-14,18H,2,5-6,9H2,1H3/t13-,14+,18? |
| InChIKey | JZNJDBFBJPVYPP-UUVAVEHKSA-N |
| XLogP | 4.01 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|