About butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine
butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine (PubChem CID 91511684) has the molecular formula C19H31N
and a molecular weight of 273.46 g/mol. Its IUPAC name is butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine.
Molecular Properties
| Compound Name | butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine |
| PubChem CID | 91511684 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCCC.[H]/N=C/CC |
| InChI | InChI=1S/C12H14.C4H10.C3H7N/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-4-2;1-2-3-4/h3-6H,7-8H2,1-2H3;3-4H2,1-2H3;3-4H,2H2,1H3/b;;4-3+ |
| InChIKey | GUFJXPZBKBEWIA-VJJINTEWSA-N |
| XLogP | 5.97 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine?
The IUPAC name of butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine (CID 91511684) is butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine.
What is the SMILES notation for butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine?
The canonical SMILES for butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine is CC1=C(C)Cc2ccccc2C1.CCCC.[H]/N=C/CC.
What is the InChIKey of butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine?
The InChIKey is GUFJXPZBKBEWIA-VJJINTEWSA-N. The full InChI is InChI=1S/C12H14.C4H10.C3H7N/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-4-2;1-2-3-4/h3-6H,7-8H2,1-2H3;3-4H2,1-2H3;3-4H,2H2,1H3/b;;4-3+.
What are the key properties of butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine?
butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine has a molecular weight of 273.46 g/mol, XLogP of 5.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2,3-dimethyl-1,4-dihydronaphthalene;propan-1-imine is sourced from PubChem (CID 91511684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).