C20H25Cl2N3O3 — CID 91511739
cyclohexylmethyl 6-(4-amino-3,5-dichlorophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 91511739) has the molecular formula C20H25Cl2N3O3 and a molecular weight of 426.34 g/mol. Its IUPAC name is cyclohexylmethyl 6-(4-amino-3,5-dichlorophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 6-(4-amino-3,5-dichlorophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91511739 |
| Molecular Formula | C20H25Cl2N3O3 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | cyclohexylmethyl 6-(4-amino-3,5-dichlorophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=NC(=O)NC(c2cc(Cl)c(N)c(Cl)c2)C1C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C20H25Cl2N3O3/c1-2-15-16(19(26)28-10-11-6-4-3-5-7-11)18(25-20(27)24-15)12-8-13(21)17(23)14(22)9-12/h8-9,11,16,18H,2-7,10,23H2,1H3,(H,25,27) |
| InChIKey | BAWODXLCQIOVRF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|