C24H30O2 — CID 91511746
(2R,4aS,10aS)-4a-[(2R)-4-phenylbutan-2-yl]-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-2,7-diol (PubChem CID 91511746) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R,4aS,10aS)-4a-[(2R)-4-phenylbutan-2-yl]-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-2,7-diol.
| Compound Name | (2R,4aS,10aS)-4a-[(2R)-4-phenylbutan-2-yl]-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-2,7-diol |
|---|---|
| PubChem CID | 91511746 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2R,4aS,10aS)-4a-[(2R)-4-phenylbutan-2-yl]-2,3,4,9,10,10a-hexahydro-1H-phenanthrene-2,7-diol |
| SMILES | C[C@H](CCc1ccccc1)[C@@]12CC[C@@H](O)C[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C24H30O2/c1-17(7-8-18-5-3-2-4-6-18)24-14-13-22(26)16-20(24)10-9-19-15-21(25)11-12-23(19)24/h2-6,11-12,15,17,20,22,25-26H,7-10,13-14,16H2,1H3/t17-,20+,22-,24+/m1/s1 |
| InChIKey | SZHXKNYBYGUIGQ-NKXAJQEDSA-N |
| XLogP | 5.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |