C15H16N2S2 — CID 91511826
3-methyl-3-[(3-methylazepin-3-yl)disulfanyl]-1-azacycloocta-1,4,6,7-tetraene (PubChem CID 91511826) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-methyl-3-[(3-methylazepin-3-yl)disulfanyl]-1-azacycloocta-1,4,6,7-tetraene.
| Compound Name | 3-methyl-3-[(3-methylazepin-3-yl)disulfanyl]-1-azacycloocta-1,4,6,7-tetraene |
|---|---|
| PubChem CID | 91511826 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-methyl-3-[(3-methylazepin-3-yl)disulfanyl]-1-azacycloocta-1,4,6,7-tetraene |
| SMILES | CC1(SSC2(C)C=CC=C=C/N=C\2)C=CC=CN=C1 |
| InChI | InChI=1S/C15H16N2S2/c1-14(8-4-3-6-10-16-12-14)18-19-15(2)9-5-7-11-17-13-15/h3-5,7-13H,1-2H3/b8-4?,16-12- |
| InChIKey | KQDVIYXSIUWXSN-WLYGGJLKSA-N |
| XLogP | 4.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|