C19H21N3O3 — CID 9151199
4-(cyclopropylamino)-3-nitro-N-(3-propan-2-ylphenyl)benzamide (PubChem CID 9151199) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-(3-propan-2-ylphenyl)benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-(3-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 9151199 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-(3-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1cccc(NC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-12(2)13-4-3-5-16(10-13)21-19(23)14-6-9-17(20-15-7-8-15)18(11-14)22(24)25/h3-6,9-12,15,20H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | BNQCIIBGTWRDOO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|