About 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile
2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile (PubChem CID 91512203) has the molecular formula C18H13F3N2O3
and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile |
| PubChem CID | 91512203 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile |
| SMILES | CC1(C)OC(=O)Nc2ccc(-c3ccc(OC(F)(F)F)cc3C#N)cc21 |
| InChI | InChI=1S/C18H13F3N2O3/c1-17(2)14-8-10(3-6-15(14)23-16(24)26-17)13-5-4-12(7-11(13)9-22)25-18(19,20)21/h3-8H,1-2H3,(H,23,24) |
| InChIKey | HCGWBABVTVGSAI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile?
The IUPAC name of 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile (CID 91512203) is 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile.
What is the SMILES notation for 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile?
The canonical SMILES for 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile is CC1(C)OC(=O)Nc2ccc(-c3ccc(OC(F)(F)F)cc3C#N)cc21.
What is the InChIKey of 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile?
The InChIKey is HCGWBABVTVGSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O3/c1-17(2)14-8-10(3-6-15(14)23-16(24)26-17)13-5-4-12(7-11(13)9-22)25-18(19,20)21/h3-8H,1-2H3,(H,23,24).
What are the key properties of 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile?
2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile has a molecular weight of 362.31 g/mol, XLogP of 4.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile is sourced from PubChem (CID 91512203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).