About 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran
5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran (PubChem CID 91512220) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran.
Molecular Properties
| Compound Name | 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran |
| PubChem CID | 91512220 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran |
| SMILES | C=CC1=C(C(=C)C(C)C)OC(C)(C)CC1 |
| InChI | InChI=1S/C14H22O/c1-7-12-8-9-14(5,6)15-13(12)11(4)10(2)3/h7,10H,1,4,8-9H2,2-3,5-6H3 |
| InChIKey | JZKHMJORMVHPPX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran?
The IUPAC name of 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran (CID 91512220) is 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran.
What is the SMILES notation for 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran?
The canonical SMILES for 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran is C=CC1=C(C(=C)C(C)C)OC(C)(C)CC1.
What is the InChIKey of 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran?
The InChIKey is JZKHMJORMVHPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-7-12-8-9-14(5,6)15-13(12)11(4)10(2)3/h7,10H,1,4,8-9H2,2-3,5-6H3.
What are the key properties of 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran?
5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran has a molecular weight of 206.33 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2,2-dimethyl-6-(3-methylbut-1-en-2-yl)-3,4-dihydropyran is sourced from PubChem (CID 91512220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).