About 2-methanimidoylcyclohexa-2,5-dien-1-amine
2-methanimidoylcyclohexa-2,5-dien-1-amine (PubChem CID 91512249) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-methanimidoylcyclohexa-2,5-dien-1-amine.
Molecular Properties
| Compound Name | 2-methanimidoylcyclohexa-2,5-dien-1-amine |
| PubChem CID | 91512249 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 2-methanimidoylcyclohexa-2,5-dien-1-amine |
| SMILES | [H]/N=C/C1=CCC=CC1N |
| InChI | InChI=1S/C7H10N2/c8-5-6-3-1-2-4-7(6)9/h2-5,7-8H,1,9H2/b8-5+ |
| InChIKey | JVNIORBXWUJJME-VMPITWQZSA-N |
| XLogP | 0.85 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoylcyclohexa-2,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoylcyclohexa-2,5-dien-1-amine?
The IUPAC name of 2-methanimidoylcyclohexa-2,5-dien-1-amine (CID 91512249) is 2-methanimidoylcyclohexa-2,5-dien-1-amine.
What is the SMILES notation for 2-methanimidoylcyclohexa-2,5-dien-1-amine?
The canonical SMILES for 2-methanimidoylcyclohexa-2,5-dien-1-amine is [H]/N=C/C1=CCC=CC1N.
What is the InChIKey of 2-methanimidoylcyclohexa-2,5-dien-1-amine?
The InChIKey is JVNIORBXWUJJME-VMPITWQZSA-N. The full InChI is InChI=1S/C7H10N2/c8-5-6-3-1-2-4-7(6)9/h2-5,7-8H,1,9H2/b8-5+.
What are the key properties of 2-methanimidoylcyclohexa-2,5-dien-1-amine?
2-methanimidoylcyclohexa-2,5-dien-1-amine has a molecular weight of 122.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoylcyclohexa-2,5-dien-1-amine is sourced from PubChem (CID 91512249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).